C26H34N2O4Si — CID 57314363
prop-2-enyl N-[(2R,3S)-2-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-4-oxoazetidin-3-yl]carbamate (PubChem CID 57314363) has the molecular formula C26H34N2O4Si and a molecular weight of 466.65 g/mol. Its IUPAC name is prop-2-enyl N-[(2R,3S)-2-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-4-oxoazetidin-3-yl]carbamate.
| Compound Name | prop-2-enyl N-[(2R,3S)-2-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-4-oxoazetidin-3-yl]carbamate |
|---|---|
| PubChem CID | 57314363 |
| Molecular Formula | C26H34N2O4Si |
| Molecular Weight | 466.65 g/mol |
| Exact Mass | 466.23 |
| IUPAC Name | prop-2-enyl N-[(2R,3S)-2-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-4-oxoazetidin-3-yl]carbamate |
| SMILES | C=CCOC(=O)N[C@@H]1C(=O)N[C@@H]1[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C26H34N2O4Si/c1-6-17-31-25(30)28-23-22(27-24(23)29)19(2)18-32-33(26(3,4)5,20-13-9-7-10-14-20)21-15-11-8-12-16-21/h6-16,19,22-23H,1,17-18H2,2-5H3,(H,27,29)(H,28,30)/t19-,22-,23+/m1/s1 |
| InChIKey | OJLWLKFOTLVPEH-PTUXOGIPSA-N |
| XLogP | 2.98 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.65 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|