C36H53NO5Si — CID 11399304
methyl (E)-6-[(1S,2R)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]hex-2-enoate (PubChem CID 11399304) has the molecular formula C36H53NO5Si and a molecular weight of 607.91 g/mol. Its IUPAC name is methyl (E)-6-[(1S,2R)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]hex-2-enoate.
| Compound Name | methyl (E)-6-[(1S,2R)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]hex-2-enoate |
|---|---|
| PubChem CID | 11399304 |
| Molecular Formula | C36H53NO5Si |
| Molecular Weight | 607.91 g/mol |
| Exact Mass | 607.37 |
| IUPAC Name | methyl (E)-6-[(1S,2R)-2-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopentyl]hex-2-enoate |
| SMILES | COC(=O)/C=C/CCC[C@@]1(NC(=O)OC(C)(C)C)CCC[C@@H]1[C@@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C36H53NO5Si/c1-28(27-41-43(35(5,6)7,29-19-12-9-13-20-29)30-21-14-10-15-22-30)31-23-18-26-36(31,37-33(39)42-34(2,3)4)25-17-11-16-24-32(38)40-8/h9-10,12-16,19-22,24,28,31H,11,17-18,23,25-27H2,1-8H3,(H,37,39)/b24-16+/t28-,31+,36+/m0/s1 |
| InChIKey | JPVLTWXBPQWMDO-HJJGCVBNSA-N |
| XLogP | 7.16 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.91 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|