C35H51NO3Si — CID 102020821
ethyl (2E,4E)-8-[(1R,2R)-1-amino-2-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]cyclopentyl]-2-methylocta-2,4-dienoate (PubChem CID 102020821) has the molecular formula C35H51NO3Si and a molecular weight of 561.88 g/mol. Its IUPAC name is ethyl (2E,4E)-8-[(1R,2R)-1-amino-2-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]cyclopentyl]-2-methylocta-2,4-dienoate.
| Compound Name | ethyl (2E,4E)-8-[(1R,2R)-1-amino-2-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]cyclopentyl]-2-methylocta-2,4-dienoate |
|---|---|
| PubChem CID | 102020821 |
| Molecular Formula | C35H51NO3Si |
| Molecular Weight | 561.88 g/mol |
| Exact Mass | 561.36 |
| IUPAC Name | ethyl (2E,4E)-8-[(1R,2R)-1-amino-2-[(2S)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]cyclopentyl]-2-methylocta-2,4-dienoate |
| SMILES | CCOC(=O)/C(C)=C/C=C/CCC[C@@]1(N)CCC[C@@H]1[C@H](C)CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H51NO3Si/c1-7-38-33(37)28(2)19-12-8-9-17-25-35(36)26-18-24-32(35)29(3)27-39-40(34(4,5)6,30-20-13-10-14-21-30)31-22-15-11-16-23-31/h8,10-16,19-23,29,32H,7,9,17-18,24-27,36H2,1-6H3/b12-8+,28-19+/t29-,32-,35-/m1/s1 |
| InChIKey | GUQLKHLDVTVRAK-GHIUUECWSA-N |
| XLogP | 6.93 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.88 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|