C39H53NO3Si — CID 135009103
benzyl (Z)-4-[(2R,6S)-6-[1-[tert-butyl(diphenyl)silyl]oxypentan-2-yl]-6-methylpiperidin-2-yl]-2-methylbut-2-enoate (PubChem CID 135009103) has the molecular formula C39H53NO3Si and a molecular weight of 611.94 g/mol. Its IUPAC name is benzyl (Z)-4-[(2R,6S)-6-[1-[tert-butyl(diphenyl)silyl]oxypentan-2-yl]-6-methylpiperidin-2-yl]-2-methylbut-2-enoate.
| Compound Name | benzyl (Z)-4-[(2R,6S)-6-[1-[tert-butyl(diphenyl)silyl]oxypentan-2-yl]-6-methylpiperidin-2-yl]-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 135009103 |
| Molecular Formula | C39H53NO3Si |
| Molecular Weight | 611.94 g/mol |
| Exact Mass | 611.38 |
| IUPAC Name | benzyl (Z)-4-[(2R,6S)-6-[1-[tert-butyl(diphenyl)silyl]oxypentan-2-yl]-6-methylpiperidin-2-yl]-2-methylbut-2-enoate |
| SMILES | CCCC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@]1(C)CCC[C@H](C/C=C(/C)C(=O)OCc2ccccc2)N1 |
| InChI | InChI=1S/C39H53NO3Si/c1-7-18-33(30-43-44(38(3,4)5,35-22-13-9-14-23-35)36-24-15-10-16-25-36)39(6)28-17-21-34(40-39)27-26-31(2)37(41)42-29-32-19-11-8-12-20-32/h8-16,19-20,22-26,33-34,40H,7,17-18,21,27-30H2,1-6H3/b31-26-/t33?,34-,39+/m1/s1 |
| InChIKey | BBKPTYAHRPXMCF-ZIAJKYNFSA-N |
| XLogP | 7.96 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.94 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|