C35H49NO3Si — CID 11432947
ethyl (2'R,6S,9aR)-2'-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]spiro[1,4,7,8,9,9a-hexahydroquinolizine-6,1'-cyclopentane]-3-carboxylate (PubChem CID 11432947) has the molecular formula C35H49NO3Si and a molecular weight of 559.87 g/mol. Its IUPAC name is ethyl (2'R,6S,9aR)-2'-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]spiro[1,4,7,8,9,9a-hexahydroquinolizine-6,1'-cyclopentane]-3-carboxylate.
| Compound Name | ethyl (2'R,6S,9aR)-2'-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]spiro[1,4,7,8,9,9a-hexahydroquinolizine-6,1'-cyclopentane]-3-carboxylate |
|---|---|
| PubChem CID | 11432947 |
| Molecular Formula | C35H49NO3Si |
| Molecular Weight | 559.87 g/mol |
| Exact Mass | 559.35 |
| IUPAC Name | ethyl (2'R,6S,9aR)-2'-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]spiro[1,4,7,8,9,9a-hexahydroquinolizine-6,1'-cyclopentane]-3-carboxylate |
| SMILES | CCOC(=O)C1=CC[C@H]2CCC[C@]3(CCC[C@@H]3[C@@H](C)CO[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)N2C1 |
| InChI | InChI=1S/C35H49NO3Si/c1-6-38-33(37)28-21-22-29-15-13-23-35(36(29)25-28)24-14-20-32(35)27(2)26-39-40(34(3,4)5,30-16-9-7-10-17-30)31-18-11-8-12-19-31/h7-12,16-19,21,27,29,32H,6,13-15,20,22-26H2,1-5H3/t27-,29+,32+,35+/m0/s1 |
| InChIKey | MPDCLWFUCWOFAT-JTNMGZGUSA-N |
| XLogP | 6.49 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.87 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|