C40H59NO3Si — CID 139262804
tert-butyl 2-[[(4R,5S,7R)-4-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-7-prop-2-enyl-6-azaspiro[4.5]decan-6-yl]methyl]prop-2-enoate (PubChem CID 139262804) has the molecular formula C40H59NO3Si and a molecular weight of 630.00 g/mol. Its IUPAC name is tert-butyl 2-[[(4R,5S,7R)-4-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-7-prop-2-enyl-6-azaspiro[4.5]decan-6-yl]methyl]prop-2-enoate.
| Compound Name | tert-butyl 2-[[(4R,5S,7R)-4-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-7-prop-2-enyl-6-azaspiro[4.5]decan-6-yl]methyl]prop-2-enoate |
|---|---|
| PubChem CID | 139262804 |
| Molecular Formula | C40H59NO3Si |
| Molecular Weight | 630.00 g/mol |
| Exact Mass | 629.43 |
| IUPAC Name | tert-butyl 2-[[(4R,5S,7R)-4-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]-7-prop-2-enyl-6-azaspiro[4.5]decan-6-yl]methyl]prop-2-enoate |
| SMILES | C=CC[C@H]1CCC[C@]2(CCC[C@@H]2[C@@H](C)CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1CC(=C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C40H59NO3Si/c1-10-19-33-20-17-27-40(41(33)30-32(3)37(42)44-38(4,5)6)28-18-25-36(40)31(2)26-29-43-45(39(7,8)9,34-21-13-11-14-22-34)35-23-15-12-16-24-35/h10-16,21-24,31,33,36H,1,3,17-20,25-30H2,2,4-9H3/t31-,33-,36+,40+/m0/s1 |
| InChIKey | GRISBCPEEMVINH-HAAIMHFSSA-N |
| XLogP | 8.46 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.00 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|