C33H45NO3Si — CID 100947237
(2'R,6S,9aR)-2'-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]spiro[1,4,7,8,9,9a-hexahydroquinolizine-6,1'-cyclopentane]-3-carboxylic acid (PubChem CID 100947237) has the molecular formula C33H45NO3Si and a molecular weight of 531.81 g/mol. Its IUPAC name is (2'R,6S,9aR)-2'-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]spiro[1,4,7,8,9,9a-hexahydroquinolizine-6,1'-cyclopentane]-3-carboxylic acid.
| Compound Name | (2'R,6S,9aR)-2'-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]spiro[1,4,7,8,9,9a-hexahydroquinolizine-6,1'-cyclopentane]-3-carboxylic acid |
|---|---|
| PubChem CID | 100947237 |
| Molecular Formula | C33H45NO3Si |
| Molecular Weight | 531.81 g/mol |
| Exact Mass | 531.32 |
| IUPAC Name | (2'R,6S,9aR)-2'-[(2R)-1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]spiro[1,4,7,8,9,9a-hexahydroquinolizine-6,1'-cyclopentane]-3-carboxylic acid |
| SMILES | C[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1CCC[C@]12CCC[C@@H]1CC=C(C(=O)O)CN12 |
| InChI | InChI=1S/C33H45NO3Si/c1-25(30-18-12-22-33(30)21-11-13-27-20-19-26(31(35)36)23-34(27)33)24-37-38(32(2,3)4,28-14-7-5-8-15-28)29-16-9-6-10-17-29/h5-10,14-17,19,25,27,30H,11-13,18,20-24H2,1-4H3,(H,35,36)/t25-,27+,30+,33+/m0/s1 |
| InChIKey | WNFJYUWDUXFIPK-TUBXXEDWSA-N |
| XLogP | 6.01 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.81 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|