C38H55NO3Si — CID 139262805
tert-butyl (2'R,6S,9aR)-2'-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]spiro[1,4,7,8,9,9a-hexahydroquinolizine-6,1'-cyclopentane]-3-carboxylate (PubChem CID 139262805) has the molecular formula C38H55NO3Si and a molecular weight of 601.95 g/mol. Its IUPAC name is tert-butyl (2'R,6S,9aR)-2'-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]spiro[1,4,7,8,9,9a-hexahydroquinolizine-6,1'-cyclopentane]-3-carboxylate.
| Compound Name | tert-butyl (2'R,6S,9aR)-2'-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]spiro[1,4,7,8,9,9a-hexahydroquinolizine-6,1'-cyclopentane]-3-carboxylate |
|---|---|
| PubChem CID | 139262805 |
| Molecular Formula | C38H55NO3Si |
| Molecular Weight | 601.95 g/mol |
| Exact Mass | 601.40 |
| IUPAC Name | tert-butyl (2'R,6S,9aR)-2'-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]spiro[1,4,7,8,9,9a-hexahydroquinolizine-6,1'-cyclopentane]-3-carboxylate |
| SMILES | C[C@@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H]1CCC[C@]12CCC[C@@H]1CC=C(C(=O)OC(C)(C)C)CN12 |
| InChI | InChI=1S/C38H55NO3Si/c1-29(24-27-41-43(37(5,6)7,32-17-10-8-11-18-32)33-19-12-9-13-20-33)34-21-15-26-38(34)25-14-16-31-23-22-30(28-39(31)38)35(40)42-36(2,3)4/h8-13,17-20,22,29,31,34H,14-16,21,23-28H2,1-7H3/t29-,31+,34+,38+/m0/s1 |
| InChIKey | LLNCBXOTNKRVFW-JJGFGWPYSA-N |
| XLogP | 7.65 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.95 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|