C29H39NO5Si — CID 11656404
dimethyl (2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-propyl-3,4-dihydro-2H-pyridine-1,6-dicarboxylate (PubChem CID 11656404) has the molecular formula C29H39NO5Si and a molecular weight of 509.72 g/mol. Its IUPAC name is dimethyl (2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-propyl-3,4-dihydro-2H-pyridine-1,6-dicarboxylate.
| Compound Name | dimethyl (2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-propyl-3,4-dihydro-2H-pyridine-1,6-dicarboxylate |
|---|---|
| PubChem CID | 11656404 |
| Molecular Formula | C29H39NO5Si |
| Molecular Weight | 509.72 g/mol |
| Exact Mass | 509.26 |
| IUPAC Name | dimethyl (2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-propyl-3,4-dihydro-2H-pyridine-1,6-dicarboxylate |
| SMILES | CCC[C@@H]1CC=C(C(=O)OC)N(C(=O)OC)[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H39NO5Si/c1-7-14-22-19-20-25(27(31)33-5)30(28(32)34-6)26(22)21-35-36(29(2,3)4,23-15-10-8-11-16-23)24-17-12-9-13-18-24/h8-13,15-18,20,22,26H,7,14,19,21H2,1-6H3/t22-,26-/m1/s1 |
| InChIKey | VYYKOLZRIOTTNP-ATIYNZHBSA-N |
| XLogP | 4.88 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.72 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|