C28H37NO5Si — CID 11179461
1-O-tert-butyl 5-O-methyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3-dihydropyrrole-1,5-dicarboxylate (PubChem CID 11179461) has the molecular formula C28H37NO5Si and a molecular weight of 495.69 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-methyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3-dihydropyrrole-1,5-dicarboxylate.
| Compound Name | 1-O-tert-butyl 5-O-methyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3-dihydropyrrole-1,5-dicarboxylate |
|---|---|
| PubChem CID | 11179461 |
| Molecular Formula | C28H37NO5Si |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | 1-O-tert-butyl 5-O-methyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-2,3-dihydropyrrole-1,5-dicarboxylate |
| SMILES | COC(=O)C1=CC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H37NO5Si/c1-27(2,3)34-26(31)29-21(18-19-24(29)25(30)32-7)20-33-35(28(4,5)6,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-17,19,21H,18,20H2,1-7H3/t21-/m0/s1 |
| InChIKey | GSYLAJFPCKICCT-NRFANRHFSA-N |
| XLogP | 4.63 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|