C32H45NO6Si — CID 156673909
tert-butyl (4S)-4-[(E,1R)-1-acetyloxy-4-[tert-butyl(diphenyl)silyl]oxybut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 156673909) has the molecular formula C32H45NO6Si and a molecular weight of 567.80 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(E,1R)-1-acetyloxy-4-[tert-butyl(diphenyl)silyl]oxybut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(E,1R)-1-acetyloxy-4-[tert-butyl(diphenyl)silyl]oxybut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 156673909 |
| Molecular Formula | C32H45NO6Si |
| Molecular Weight | 567.80 g/mol |
| Exact Mass | 567.30 |
| IUPAC Name | tert-butyl (4S)-4-[(E,1R)-1-acetyloxy-4-[tert-butyl(diphenyl)silyl]oxybut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC(=O)O[C@H](/C=C/CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H45NO6Si/c1-24(34)38-28(27-23-36-32(8,9)33(27)29(35)39-30(2,3)4)21-16-22-37-40(31(5,6)7,25-17-12-10-13-18-25)26-19-14-11-15-20-26/h10-21,27-28H,22-23H2,1-9H3/b21-16+/t27-,28+/m0/s1 |
| InChIKey | LKQKQGWOEBUHPD-XRVBOJJVSA-N |
| XLogP | 5.42 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.80 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|