C31H45NO5Si — CID 134835663
tert-butyl N-[(2S,3S)-1-[tert-butyl(diphenyl)silyl]oxy-3-(methoxymethoxy)pent-4-en-2-yl]-N-prop-2-enylcarbamate (PubChem CID 134835663) has the molecular formula C31H45NO5Si and a molecular weight of 539.79 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S)-1-[tert-butyl(diphenyl)silyl]oxy-3-(methoxymethoxy)pent-4-en-2-yl]-N-prop-2-enylcarbamate.
| Compound Name | tert-butyl N-[(2S,3S)-1-[tert-butyl(diphenyl)silyl]oxy-3-(methoxymethoxy)pent-4-en-2-yl]-N-prop-2-enylcarbamate |
|---|---|
| PubChem CID | 134835663 |
| Molecular Formula | C31H45NO5Si |
| Molecular Weight | 539.79 g/mol |
| Exact Mass | 539.31 |
| IUPAC Name | tert-butyl N-[(2S,3S)-1-[tert-butyl(diphenyl)silyl]oxy-3-(methoxymethoxy)pent-4-en-2-yl]-N-prop-2-enylcarbamate |
| SMILES | C=CCN(C(=O)OC(C)(C)C)[C@@H](CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)[C@H](C=C)OCOC |
| InChI | InChI=1S/C31H45NO5Si/c1-10-22-32(29(33)37-30(3,4)5)27(28(11-2)35-24-34-9)23-36-38(31(6,7)8,25-18-14-12-15-19-25)26-20-16-13-17-21-26/h10-21,27-28H,1-2,22-24H2,3-9H3/t27-,28-/m0/s1 |
| InChIKey | FWLQOHYCAHVUSK-NSOVKSMOSA-N |
| XLogP | 5.53 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.79 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|