C29H43NO5Si — CID 134835662
tert-butyl (2S,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(methoxymethoxy)piperidine-1-carboxylate (PubChem CID 134835662) has the molecular formula C29H43NO5Si and a molecular weight of 513.75 g/mol. Its IUPAC name is tert-butyl (2S,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(methoxymethoxy)piperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(methoxymethoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 134835662 |
| Molecular Formula | C29H43NO5Si |
| Molecular Weight | 513.75 g/mol |
| Exact Mass | 513.29 |
| IUPAC Name | tert-butyl (2S,3S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-(methoxymethoxy)piperidine-1-carboxylate |
| SMILES | COCO[C@H]1CCCN(C(=O)OC(C)(C)C)[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H43NO5Si/c1-28(2,3)35-27(31)30-20-14-19-26(33-22-32-7)25(30)21-34-36(29(4,5)6,23-15-10-8-11-16-23)24-17-12-9-13-18-24/h8-13,15-18,25-26H,14,19-22H2,1-7H3/t25-,26-/m0/s1 |
| InChIKey | MXFFYCZLYKNWCC-UIOOFZCWSA-N |
| XLogP | 4.95 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.75 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|