C25H35NO4Si — CID 10983072
methyl 4-[tert-butyl(diphenyl)silyl]oxy-2-ethoxypiperidine-1-carboxylate (PubChem CID 10983072) has the molecular formula C25H35NO4Si and a molecular weight of 441.64 g/mol. Its IUPAC name is methyl 4-[tert-butyl(diphenyl)silyl]oxy-2-ethoxypiperidine-1-carboxylate.
| Compound Name | methyl 4-[tert-butyl(diphenyl)silyl]oxy-2-ethoxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 10983072 |
| Molecular Formula | C25H35NO4Si |
| Molecular Weight | 441.64 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | methyl 4-[tert-butyl(diphenyl)silyl]oxy-2-ethoxypiperidine-1-carboxylate |
| SMILES | CCOC1CC(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCN1C(=O)OC |
| InChI | InChI=1S/C25H35NO4Si/c1-6-29-23-19-20(17-18-26(23)24(27)28-5)30-31(25(2,3)4,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,20,23H,6,17-19H2,1-5H3 |
| InChIKey | MJXSPHYUDYORAI-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.64 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|