C33H49NO4Si — CID 11215004
ethyl N-[2-[(6R)-6-[tert-butyl(diphenyl)silyl]oxycyclohexen-1-yl]ethyl]-N-(1-ethoxy-2-methylpropyl)carbamate (PubChem CID 11215004) has the molecular formula C33H49NO4Si and a molecular weight of 551.84 g/mol. Its IUPAC name is ethyl N-[2-[(6R)-6-[tert-butyl(diphenyl)silyl]oxycyclohexen-1-yl]ethyl]-N-(1-ethoxy-2-methylpropyl)carbamate.
| Compound Name | ethyl N-[2-[(6R)-6-[tert-butyl(diphenyl)silyl]oxycyclohexen-1-yl]ethyl]-N-(1-ethoxy-2-methylpropyl)carbamate |
|---|---|
| PubChem CID | 11215004 |
| Molecular Formula | C33H49NO4Si |
| Molecular Weight | 551.84 g/mol |
| Exact Mass | 551.34 |
| IUPAC Name | ethyl N-[2-[(6R)-6-[tert-butyl(diphenyl)silyl]oxycyclohexen-1-yl]ethyl]-N-(1-ethoxy-2-methylpropyl)carbamate |
| SMILES | CCOC(=O)N(CCC1=CCCC[C@H]1O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(OCC)C(C)C |
| InChI | InChI=1S/C33H49NO4Si/c1-8-36-31(26(3)4)34(32(35)37-9-2)25-24-27-18-16-17-23-30(27)38-39(33(5,6)7,28-19-12-10-13-20-28)29-21-14-11-15-22-29/h10-15,18-22,26,30-31H,8-9,16-17,23-25H2,1-7H3/t30-,31?/m1/s1 |
| InChIKey | DKBHXYKBZYQJTF-PBBFAOSKSA-N |
| XLogP | 6.91 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.84 |
| LogP ≤ 5 | 6.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|