C26H35NO3Si — CID 11133917
methyl (2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-prop-2-enylpiperidine-1-carboxylate (PubChem CID 11133917) has the molecular formula C26H35NO3Si and a molecular weight of 437.66 g/mol. Its IUPAC name is methyl (2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-prop-2-enylpiperidine-1-carboxylate.
| Compound Name | methyl (2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-prop-2-enylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 11133917 |
| Molecular Formula | C26H35NO3Si |
| Molecular Weight | 437.66 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | methyl (2S,4R)-4-[tert-butyl(diphenyl)silyl]oxy-2-prop-2-enylpiperidine-1-carboxylate |
| SMILES | C=CC[C@H]1C[C@H](O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)CCN1C(=O)OC |
| InChI | InChI=1S/C26H35NO3Si/c1-6-13-21-20-22(18-19-27(21)25(28)29-5)30-31(26(2,3)4,23-14-9-7-10-15-23)24-16-11-8-12-17-24/h6-12,14-17,21-22H,1,13,18-20H2,2-5H3/t21-,22+/m0/s1 |
| InChIKey | VYWPAMAGNOGKJW-FCHUYYIVSA-N |
| XLogP | 4.74 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.66 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|