C27H39NO5Si — CID 135067649
tert-butyl (4R,5R)-3-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-5-(hydroxymethyl)piperidine-1-carboxylate (PubChem CID 135067649) has the molecular formula C27H39NO5Si and a molecular weight of 485.70 g/mol. Its IUPAC name is tert-butyl (4R,5R)-3-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-5-(hydroxymethyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl (4R,5R)-3-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-5-(hydroxymethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 135067649 |
| Molecular Formula | C27H39NO5Si |
| Molecular Weight | 485.70 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | tert-butyl (4R,5R)-3-[tert-butyl(diphenyl)silyl]oxy-4-hydroxy-5-(hydroxymethyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(O[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)[C@H](O)[C@@H](CO)C1 |
| InChI | InChI=1S/C27H39NO5Si/c1-26(2,3)32-25(31)28-17-20(19-29)24(30)23(18-28)33-34(27(4,5)6,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,20,23-24,29-30H,17-19H2,1-6H3/t20-,23?,24-/m1/s1 |
| InChIKey | UDNMFYIFSQIZSS-WGNZSGQMSA-N |
| XLogP | 3.15 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.70 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|