C35H53NO7Si — CID 135025527
[(2S,6R)-1-[4-[tert-butyl(diphenyl)silyl]oxybutanoyl]-6-[(1R)-1-(2-methoxyethoxymethoxy)propyl]piperidin-2-yl]methyl acetate (PubChem CID 135025527) has the molecular formula C35H53NO7Si and a molecular weight of 627.90 g/mol. Its IUPAC name is [(2S,6R)-1-[4-[tert-butyl(diphenyl)silyl]oxybutanoyl]-6-[(1R)-1-(2-methoxyethoxymethoxy)propyl]piperidin-2-yl]methyl acetate.
| Compound Name | [(2S,6R)-1-[4-[tert-butyl(diphenyl)silyl]oxybutanoyl]-6-[(1R)-1-(2-methoxyethoxymethoxy)propyl]piperidin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 135025527 |
| Molecular Formula | C35H53NO7Si |
| Molecular Weight | 627.90 g/mol |
| Exact Mass | 627.36 |
| IUPAC Name | [(2S,6R)-1-[4-[tert-butyl(diphenyl)silyl]oxybutanoyl]-6-[(1R)-1-(2-methoxyethoxymethoxy)propyl]piperidin-2-yl]methyl acetate |
| SMILES | CC[C@@H](OCOCCOC)[C@H]1CCC[C@@H](COC(C)=O)N1C(=O)CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C35H53NO7Si/c1-7-33(42-27-40-25-24-39-6)32-21-14-16-29(26-41-28(2)37)36(32)34(38)22-15-23-43-44(35(3,4)5,30-17-10-8-11-18-30)31-19-12-9-13-20-31/h8-13,17-20,29,32-33H,7,14-16,21-27H2,1-6H3/t29-,32+,33+/m0/s1 |
| InChIKey | JFJNRVSKCQGVQY-PHCUSUGSSA-N |
| XLogP | 5.07 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.90 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|