C29H39NO7Si — CID 10768838
dimethyl (2R,3S,6S)-3-acetyloxy-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]piperidine-1,2-dicarboxylate (PubChem CID 10768838) has the molecular formula C29H39NO7Si and a molecular weight of 541.72 g/mol. Its IUPAC name is dimethyl (2R,3S,6S)-3-acetyloxy-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]piperidine-1,2-dicarboxylate.
| Compound Name | dimethyl (2R,3S,6S)-3-acetyloxy-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]piperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10768838 |
| Molecular Formula | C29H39NO7Si |
| Molecular Weight | 541.72 g/mol |
| Exact Mass | 541.25 |
| IUPAC Name | dimethyl (2R,3S,6S)-3-acetyloxy-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]piperidine-1,2-dicarboxylate |
| SMILES | COC(=O)[C@H]1[C@@H](OC(C)=O)CC[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1C(=O)OC |
| InChI | InChI=1S/C29H39NO7Si/c1-21(31)37-25-18-17-22(30(28(33)35-6)26(25)27(32)34-5)19-20-36-38(29(2,3)4,23-13-9-7-10-14-23)24-15-11-8-12-16-24/h7-16,22,25-26H,17-20H2,1-6H3/t22-,25-,26+/m0/s1 |
| InChIKey | ILIBGJDTXYGCSC-UCGXPXSYSA-N |
| XLogP | 3.66 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.72 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|