C28H39NO6Si — CID 10839520
methyl (2R,3S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-formyl-3-(methoxymethoxy)piperidine-1-carboxylate (PubChem CID 10839520) has the molecular formula C28H39NO6Si and a molecular weight of 513.71 g/mol. Its IUPAC name is methyl (2R,3S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-formyl-3-(methoxymethoxy)piperidine-1-carboxylate.
| Compound Name | methyl (2R,3S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-formyl-3-(methoxymethoxy)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10839520 |
| Molecular Formula | C28H39NO6Si |
| Molecular Weight | 513.71 g/mol |
| Exact Mass | 513.25 |
| IUPAC Name | methyl (2R,3S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-2-formyl-3-(methoxymethoxy)piperidine-1-carboxylate |
| SMILES | COCO[C@H]1CC[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N(C(=O)OC)[C@H]1C=O |
| InChI | InChI=1S/C28H39NO6Si/c1-28(2,3)36(23-12-8-6-9-13-23,24-14-10-7-11-15-24)35-19-18-22-16-17-26(34-21-32-4)25(20-30)29(22)27(31)33-5/h6-15,20,22,25-26H,16-19,21H2,1-5H3/t22-,25-,26-/m0/s1 |
| InChIKey | KBYGVASSONJPMS-HRNNMHKYSA-N |
| XLogP | 3.74 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.71 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|