C29H41NO7Si — CID 10840256
dimethyl (2R,3S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-(methoxymethoxy)piperidine-1,2-dicarboxylate (PubChem CID 10840256) has the molecular formula C29H41NO7Si and a molecular weight of 543.73 g/mol. Its IUPAC name is dimethyl (2R,3S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-(methoxymethoxy)piperidine-1,2-dicarboxylate.
| Compound Name | dimethyl (2R,3S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-(methoxymethoxy)piperidine-1,2-dicarboxylate |
|---|---|
| PubChem CID | 10840256 |
| Molecular Formula | C29H41NO7Si |
| Molecular Weight | 543.73 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | dimethyl (2R,3S,6S)-6-[2-[tert-butyl(diphenyl)silyl]oxyethyl]-3-(methoxymethoxy)piperidine-1,2-dicarboxylate |
| SMILES | COCO[C@H]1CC[C@@H](CCO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N(C(=O)OC)[C@H]1C(=O)OC |
| InChI | InChI=1S/C29H41NO7Si/c1-29(2,3)38(23-13-9-7-10-14-23,24-15-11-8-12-16-24)37-20-19-22-17-18-25(36-21-33-4)26(27(31)34-5)30(22)28(32)35-6/h7-16,22,25-26H,17-21H2,1-6H3/t22-,25-,26+/m0/s1 |
| InChIKey | CXFBXZHPULASPF-UCGXPXSYSA-N |
| XLogP | 3.71 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.73 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|