C33H51NO6Si — CID 135025528
4-[tert-butyl(diphenyl)silyl]oxy-1-[(2S,6R)-2-(hydroxymethyl)-6-[(1R)-1-(2-methoxyethoxymethoxy)propyl]piperidin-1-yl]butan-1-one (PubChem CID 135025528) has the molecular formula C33H51NO6Si and a molecular weight of 585.86 g/mol. Its IUPAC name is 4-[tert-butyl(diphenyl)silyl]oxy-1-[(2S,6R)-2-(hydroxymethyl)-6-[(1R)-1-(2-methoxyethoxymethoxy)propyl]piperidin-1-yl]butan-1-one.
| Compound Name | 4-[tert-butyl(diphenyl)silyl]oxy-1-[(2S,6R)-2-(hydroxymethyl)-6-[(1R)-1-(2-methoxyethoxymethoxy)propyl]piperidin-1-yl]butan-1-one |
|---|---|
| PubChem CID | 135025528 |
| Molecular Formula | C33H51NO6Si |
| Molecular Weight | 585.86 g/mol |
| Exact Mass | 585.35 |
| IUPAC Name | 4-[tert-butyl(diphenyl)silyl]oxy-1-[(2S,6R)-2-(hydroxymethyl)-6-[(1R)-1-(2-methoxyethoxymethoxy)propyl]piperidin-1-yl]butan-1-one |
| SMILES | CC[C@@H](OCOCCOC)[C@H]1CCC[C@@H](CO)N1C(=O)CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C33H51NO6Si/c1-6-31(39-26-38-24-23-37-5)30-20-13-15-27(25-35)34(30)32(36)21-14-22-40-41(33(2,3)4,28-16-9-7-10-17-28)29-18-11-8-12-19-29/h7-12,16-19,27,30-31,35H,6,13-15,20-26H2,1-5H3/t27-,30+,31+/m0/s1 |
| InChIKey | XNXHRJPDYPBTHN-LXLYTFERSA-N |
| XLogP | 4.50 |
| TPSA | 77.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.86 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|