C28H42O2Si — CID 140750443
3-[2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]cyclopentyl]propan-1-ol (PubChem CID 140750443) has the molecular formula C28H42O2Si and a molecular weight of 438.73 g/mol. Its IUPAC name is 3-[2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]cyclopentyl]propan-1-ol.
| Compound Name | 3-[2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]cyclopentyl]propan-1-ol |
|---|---|
| PubChem CID | 140750443 |
| Molecular Formula | C28H42O2Si |
| Molecular Weight | 438.73 g/mol |
| Exact Mass | 438.30 |
| IUPAC Name | 3-[2-[(2S)-4-[tert-butyl(diphenyl)silyl]oxybutan-2-yl]cyclopentyl]propan-1-ol |
| SMILES | C[C@@H](CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C1CCCC1CCCO |
| InChI | InChI=1S/C28H42O2Si/c1-23(27-19-11-13-24(27)14-12-21-29)20-22-30-31(28(2,3)4,25-15-7-5-8-16-25)26-17-9-6-10-18-26/h5-10,15-18,23-24,27,29H,11-14,19-22H2,1-4H3/t23-,24?,27?/m0/s1 |
| InChIKey | ISNDQHJYYBYOGI-HVNPKJTBSA-N |
| XLogP | 5.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.73 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|