C36H53NO7Si — CID 135025530
methyl (E)-3-[(2S,6R)-1-[4-[tert-butyl(diphenyl)silyl]oxybutanoyl]-6-[(1R)-1-(2-methoxyethoxymethoxy)propyl]piperidin-2-yl]prop-2-enoate (PubChem CID 135025530) has the molecular formula C36H53NO7Si and a molecular weight of 639.91 g/mol. Its IUPAC name is methyl (E)-3-[(2S,6R)-1-[4-[tert-butyl(diphenyl)silyl]oxybutanoyl]-6-[(1R)-1-(2-methoxyethoxymethoxy)propyl]piperidin-2-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(2S,6R)-1-[4-[tert-butyl(diphenyl)silyl]oxybutanoyl]-6-[(1R)-1-(2-methoxyethoxymethoxy)propyl]piperidin-2-yl]prop-2-enoate |
|---|---|
| PubChem CID | 135025530 |
| Molecular Formula | C36H53NO7Si |
| Molecular Weight | 639.91 g/mol |
| Exact Mass | 639.36 |
| IUPAC Name | methyl (E)-3-[(2S,6R)-1-[4-[tert-butyl(diphenyl)silyl]oxybutanoyl]-6-[(1R)-1-(2-methoxyethoxymethoxy)propyl]piperidin-2-yl]prop-2-enoate |
| SMILES | CC[C@@H](OCOCCOC)[C@H]1CCC[C@@H](/C=C/C(=O)OC)N1C(=O)CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C36H53NO7Si/c1-7-33(43-28-42-27-26-40-5)32-21-14-16-29(23-24-35(39)41-6)37(32)34(38)22-15-25-44-45(36(2,3)4,30-17-10-8-11-18-30)31-19-12-9-13-20-31/h8-13,17-20,23-24,29,32-33H,7,14-16,21-22,25-28H2,1-6H3/b24-23+/t29-,32+,33+/m0/s1 |
| InChIKey | FPOZOEMJQUBTLF-RTOGXGGMSA-N |
| XLogP | 5.24 |
| TPSA | 83.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.91 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|