C26H33NO5Si — CID 11351825
dimethyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyridine-1,6-dicarboxylate (PubChem CID 11351825) has the molecular formula C26H33NO5Si and a molecular weight of 467.64 g/mol. Its IUPAC name is dimethyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyridine-1,6-dicarboxylate.
| Compound Name | dimethyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyridine-1,6-dicarboxylate |
|---|---|
| PubChem CID | 11351825 |
| Molecular Formula | C26H33NO5Si |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.21 |
| IUPAC Name | dimethyl (2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3,4-dihydro-2H-pyridine-1,6-dicarboxylate |
| SMILES | COC(=O)C1=CCC[C@@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1C(=O)OC |
| InChI | InChI=1S/C26H33NO5Si/c1-26(2,3)33(21-14-8-6-9-15-21,22-16-10-7-11-17-22)32-19-20-13-12-18-23(24(28)30-4)27(20)25(29)31-5/h6-11,14-18,20H,12-13,19H2,1-5H3/t20-/m0/s1 |
| InChIKey | HMVPVFOGZWIWOD-FQEVSTJZSA-N |
| XLogP | 3.85 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|