C30H41NO6Si — CID 135070430
methyl (E)-7-[tert-butyl(diphenyl)silyl]oxy-6-[formyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hept-2-enoate (PubChem CID 135070430) has the molecular formula C30H41NO6Si and a molecular weight of 539.75 g/mol. Its IUPAC name is methyl (E)-7-[tert-butyl(diphenyl)silyl]oxy-6-[formyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hept-2-enoate.
| Compound Name | methyl (E)-7-[tert-butyl(diphenyl)silyl]oxy-6-[formyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hept-2-enoate |
|---|---|
| PubChem CID | 135070430 |
| Molecular Formula | C30H41NO6Si |
| Molecular Weight | 539.75 g/mol |
| Exact Mass | 539.27 |
| IUPAC Name | methyl (E)-7-[tert-butyl(diphenyl)silyl]oxy-6-[formyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hept-2-enoate |
| SMILES | COC(=O)/C=C/CCC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)N(C=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H41NO6Si/c1-29(2,3)37-28(34)31(23-32)24(16-14-15-21-27(33)35-7)22-36-38(30(4,5)6,25-17-10-8-11-18-25)26-19-12-9-13-20-26/h8-13,15,17-21,23-24H,14,16,22H2,1-7H3/b21-15+ |
| InChIKey | RGMJURZRHNDGPQ-RCCKNPSSSA-N |
| XLogP | 4.83 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.75 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|