C28H37NO5Si — CID 11294892
dimethyl (2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-ethyl-3,4-dihydro-2H-pyridine-1,6-dicarboxylate (PubChem CID 11294892) has the molecular formula C28H37NO5Si and a molecular weight of 495.69 g/mol. Its IUPAC name is dimethyl (2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-ethyl-3,4-dihydro-2H-pyridine-1,6-dicarboxylate.
| Compound Name | dimethyl (2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-ethyl-3,4-dihydro-2H-pyridine-1,6-dicarboxylate |
|---|---|
| PubChem CID | 11294892 |
| Molecular Formula | C28H37NO5Si |
| Molecular Weight | 495.69 g/mol |
| Exact Mass | 495.24 |
| IUPAC Name | dimethyl (2S,3R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-ethyl-3,4-dihydro-2H-pyridine-1,6-dicarboxylate |
| SMILES | CC[C@@H]1CC=C(C(=O)OC)N(C(=O)OC)[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H37NO5Si/c1-7-21-18-19-24(26(30)32-5)29(27(31)33-6)25(21)20-34-35(28(2,3)4,22-14-10-8-11-15-22)23-16-12-9-13-17-23/h8-17,19,21,25H,7,18,20H2,1-6H3/t21-,25-/m1/s1 |
| InChIKey | XIJLSEOPOBTJCE-PXDATVDWSA-N |
| XLogP | 4.49 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.69 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|