C30H41NO5Si — CID 11226230
methyl (2S,3S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3-methylpiperidine-1-carboxylate (PubChem CID 11226230) has the molecular formula C30H41NO5Si and a molecular weight of 523.75 g/mol. Its IUPAC name is methyl (2S,3S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3-methylpiperidine-1-carboxylate.
| Compound Name | methyl (2S,3S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 11226230 |
| Molecular Formula | C30H41NO5Si |
| Molecular Weight | 523.75 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | methyl (2S,3S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-[(E)-3-ethoxy-3-oxoprop-1-enyl]-3-methylpiperidine-1-carboxylate |
| SMILES | CCOC(=O)/C=C/[C@@H]1[C@@H](C)CC[C@H](CO[Si](c2ccccc2)(c2ccccc2)C(C)(C)C)N1C(=O)OC |
| InChI | InChI=1S/C30H41NO5Si/c1-7-35-28(32)21-20-27-23(2)18-19-24(31(27)29(33)34-6)22-36-37(30(3,4)5,25-14-10-8-11-15-25)26-16-12-9-13-17-26/h8-17,20-21,23-24,27H,7,18-19,22H2,1-6H3/b21-20+/t23-,24+,27+/m0/s1 |
| InChIKey | WIBHKJOLAVFDDG-ZJGCCJPSSA-N |
| XLogP | 4.92 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.75 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|