C23H35NO5Si — CID 11102109
benzyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-3-methoxy-3-oxoprop-1-enyl]piperidine-1-carboxylate (PubChem CID 11102109) has the molecular formula C23H35NO5Si and a molecular weight of 433.62 g/mol. Its IUPAC name is benzyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-3-methoxy-3-oxoprop-1-enyl]piperidine-1-carboxylate.
| Compound Name | benzyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-3-methoxy-3-oxoprop-1-enyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 11102109 |
| Molecular Formula | C23H35NO5Si |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.23 |
| IUPAC Name | benzyl (2S,3R)-3-[tert-butyl(dimethyl)silyl]oxy-2-[(Z)-3-methoxy-3-oxoprop-1-enyl]piperidine-1-carboxylate |
| SMILES | COC(=O)/C=C\[C@H]1[C@H](O[Si](C)(C)C(C)(C)C)CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H35NO5Si/c1-23(2,3)30(5,6)29-20-13-10-16-24(19(20)14-15-21(25)27-4)22(26)28-17-18-11-8-7-9-12-18/h7-9,11-12,14-15,19-20H,10,13,16-17H2,1-6H3/b15-14-/t19-,20+/m0/s1 |
| InChIKey | SEBGQUIJASPHBP-ATGVFMLPSA-N |
| XLogP | 4.91 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|