C24H40N2O5Si — CID 11070637
1-O-benzyl 2-O-tert-butyl (3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]diazinane-1,2-dicarboxylate (PubChem CID 11070637) has the molecular formula C24H40N2O5Si and a molecular weight of 464.68 g/mol. Its IUPAC name is 1-O-benzyl 2-O-tert-butyl (3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]diazinane-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-tert-butyl (3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]diazinane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11070637 |
| Molecular Formula | C24H40N2O5Si |
| Molecular Weight | 464.68 g/mol |
| Exact Mass | 464.27 |
| IUPAC Name | 1-O-benzyl 2-O-tert-butyl (3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]diazinane-1,2-dicarboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H](CO[Si](C)(C)C(C)(C)C)CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C24H40N2O5Si/c1-23(2,3)31-22(28)26-20(18-30-32(7,8)24(4,5)6)15-12-16-25(26)21(27)29-17-19-13-10-9-11-14-19/h9-11,13-14,20H,12,15-18H2,1-8H3/t20-/m1/s1 |
| InChIKey | GBZASNDLCFDXEX-HXUWFJFHSA-N |
| XLogP | 5.96 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.68 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|