C27H38N2O5Si — CID 11283404
dibenzyl (3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]diazinane-1,2-dicarboxylate (PubChem CID 11283404) has the molecular formula C27H38N2O5Si and a molecular weight of 498.70 g/mol. Its IUPAC name is dibenzyl (3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]diazinane-1,2-dicarboxylate.
| Compound Name | dibenzyl (3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]diazinane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11283404 |
| Molecular Formula | C27H38N2O5Si |
| Molecular Weight | 498.70 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | dibenzyl (3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]diazinane-1,2-dicarboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1CCCN(C(=O)OCc2ccccc2)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C27H38N2O5Si/c1-27(2,3)35(4,5)34-21-24-17-12-18-28(25(30)32-19-22-13-8-6-9-14-22)29(24)26(31)33-20-23-15-10-7-11-16-23/h6-11,13-16,24H,12,17-21H2,1-5H3/t24-/m1/s1 |
| InChIKey | GATCPDKFWHQSNB-XMMPIXPASA-N |
| XLogP | 6.36 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.70 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|