C23H34N2O4 — CID 11429562
benzyl N-[(2-methylpropan-2-yl)oxycarbonyl-pent-4-enylamino]-N-pent-4-enylcarbamate (PubChem CID 11429562) has the molecular formula C23H34N2O4 and a molecular weight of 402.54 g/mol. Its IUPAC name is benzyl N-[(2-methylpropan-2-yl)oxycarbonyl-pent-4-enylamino]-N-pent-4-enylcarbamate.
| Compound Name | benzyl N-[(2-methylpropan-2-yl)oxycarbonyl-pent-4-enylamino]-N-pent-4-enylcarbamate |
|---|---|
| PubChem CID | 11429562 |
| Molecular Formula | C23H34N2O4 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.25 |
| IUPAC Name | benzyl N-[(2-methylpropan-2-yl)oxycarbonyl-pent-4-enylamino]-N-pent-4-enylcarbamate |
| SMILES | C=CCCCN(C(=O)OCc1ccccc1)N(CCCC=C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H34N2O4/c1-6-8-13-17-24(21(26)28-19-20-15-11-10-12-16-20)25(18-14-9-7-2)22(27)29-23(3,4)5/h6-7,10-12,15-16H,1-2,8-9,13-14,17-19H2,3-5H3 |
| InChIKey | BAGSKFLOIJXAFT-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|