C33H53NO6Si — CID 10531431
benzyl (2S,3R,6R)-6-[(4R)-5-(2,2-dimethylpropanoyloxy)-4-hydroxypent-1-ynyl]-2-methyl-3-tri(propan-2-yl)silyloxypiperidine-1-carboxylate (PubChem CID 10531431) has the molecular formula C33H53NO6Si and a molecular weight of 587.87 g/mol. Its IUPAC name is benzyl (2S,3R,6R)-6-[(4R)-5-(2,2-dimethylpropanoyloxy)-4-hydroxypent-1-ynyl]-2-methyl-3-tri(propan-2-yl)silyloxypiperidine-1-carboxylate.
| Compound Name | benzyl (2S,3R,6R)-6-[(4R)-5-(2,2-dimethylpropanoyloxy)-4-hydroxypent-1-ynyl]-2-methyl-3-tri(propan-2-yl)silyloxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 10531431 |
| Molecular Formula | C33H53NO6Si |
| Molecular Weight | 587.87 g/mol |
| Exact Mass | 587.36 |
| IUPAC Name | benzyl (2S,3R,6R)-6-[(4R)-5-(2,2-dimethylpropanoyloxy)-4-hydroxypent-1-ynyl]-2-methyl-3-tri(propan-2-yl)silyloxypiperidine-1-carboxylate |
| SMILES | CC(C)[Si](O[C@@H]1CC[C@H](C#CC[C@@H](O)COC(=O)C(C)(C)C)N(C(=O)OCc2ccccc2)[C@H]1C)(C(C)C)C(C)C |
| InChI | InChI=1S/C33H53NO6Si/c1-23(2)41(24(3)4,25(5)6)40-30-20-19-28(17-14-18-29(35)22-38-31(36)33(8,9)10)34(26(30)7)32(37)39-21-27-15-12-11-13-16-27/h11-13,15-16,23-26,28-30,35H,18-22H2,1-10H3/t26-,28-,29+,30+/m0/s1 |
| InChIKey | AQZIKZBBYYZSKH-ZYVKACNBSA-N |
| XLogP | 7.08 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.87 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|