C23H37NO5Si — CID 56834511
benzyl (5S)-5-[(E,1S)-4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxybut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 56834511) has the molecular formula C23H37NO5Si and a molecular weight of 435.64 g/mol. Its IUPAC name is benzyl (5S)-5-[(E,1S)-4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxybut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | benzyl (5S)-5-[(E,1S)-4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxybut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 56834511 |
| Molecular Formula | C23H37NO5Si |
| Molecular Weight | 435.64 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | benzyl (5S)-5-[(E,1S)-4-[tert-butyl(dimethyl)silyl]oxy-1-hydroxybut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | CC1(C)O[C@H]([C@@H](O)/C=C/CO[Si](C)(C)C(C)(C)C)CN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C23H37NO5Si/c1-22(2,3)30(6,7)28-15-11-14-19(25)20-16-24(23(4,5)29-20)21(26)27-17-18-12-9-8-10-13-18/h8-14,19-20,25H,15-17H2,1-7H3/b14-11+/t19-,20-/m0/s1 |
| InChIKey | XOIXUTVMRNIOJW-MKIFFDSSSA-N |
| XLogP | 4.70 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.64 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|