C34H59NO4Si2 — CID 134872604
7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-1-[(2S)-2-(phenylmethoxymethyl)piperidin-1-yl]oct-2-yn-1-one (PubChem CID 134872604) has the molecular formula C34H59NO4Si2 and a molecular weight of 602.02 g/mol. Its IUPAC name is 7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-1-[(2S)-2-(phenylmethoxymethyl)piperidin-1-yl]oct-2-yn-1-one.
| Compound Name | 7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-1-[(2S)-2-(phenylmethoxymethyl)piperidin-1-yl]oct-2-yn-1-one |
|---|---|
| PubChem CID | 134872604 |
| Molecular Formula | C34H59NO4Si2 |
| Molecular Weight | 602.02 g/mol |
| Exact Mass | 601.40 |
| IUPAC Name | 7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-1-[(2S)-2-(phenylmethoxymethyl)piperidin-1-yl]oct-2-yn-1-one |
| SMILES | CC(C#CC(=O)N1CCCC[C@H]1COCc1ccccc1)CCC(CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C34H59NO4Si2/c1-28(20-22-31(39-41(10,11)34(5,6)7)27-38-40(8,9)33(2,3)4)21-23-32(36)35-24-16-15-19-30(35)26-37-25-29-17-13-12-14-18-29/h12-14,17-18,28,30-31H,15-16,19-20,22,24-27H2,1-11H3/t28?,30-,31?/m0/s1 |
| InChIKey | JLIVTMZNHCETGH-SYAFCRNZSA-N |
| XLogP | 8.42 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.02 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|