C33H55NO5Si2 — CID 134872573
benzyl (2S)-1-[7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyloct-2-ynoyl]pyrrolidine-2-carboxylate (PubChem CID 134872573) has the molecular formula C33H55NO5Si2 and a molecular weight of 601.98 g/mol. Its IUPAC name is benzyl (2S)-1-[7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyloct-2-ynoyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S)-1-[7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyloct-2-ynoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 134872573 |
| Molecular Formula | C33H55NO5Si2 |
| Molecular Weight | 601.98 g/mol |
| Exact Mass | 601.36 |
| IUPAC Name | benzyl (2S)-1-[7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyloct-2-ynoyl]pyrrolidine-2-carboxylate |
| SMILES | CC(C#CC(=O)N1CCC[C@H]1C(=O)OCc1ccccc1)CCC(CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C33H55NO5Si2/c1-26(19-21-28(39-41(10,11)33(5,6)7)25-38-40(8,9)32(2,3)4)20-22-30(35)34-23-15-18-29(34)31(36)37-24-27-16-13-12-14-17-27/h12-14,16-17,26,28-29H,15,18-19,21,23-25H2,1-11H3/t26?,28?,29-/m0/s1 |
| InChIKey | XGBSXTWMDMAPIE-VAVIJBCFSA-N |
| XLogP | 7.55 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.98 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|