C22H35NO5Si — CID 146163502
benzyl N-acetyl-N-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]carbamate (PubChem CID 146163502) has the molecular formula C22H35NO5Si and a molecular weight of 421.61 g/mol. Its IUPAC name is benzyl N-acetyl-N-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]carbamate.
| Compound Name | benzyl N-acetyl-N-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 146163502 |
| Molecular Formula | C22H35NO5Si |
| Molecular Weight | 421.61 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | benzyl N-acetyl-N-[[(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxyoxan-2-yl]methyl]carbamate |
| SMILES | CC(=O)N(C[C@H]1OCCC[C@@H]1O[Si](C)(C)C(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H35NO5Si/c1-17(24)23(21(25)27-16-18-11-8-7-9-12-18)15-20-19(13-10-14-26-20)28-29(5,6)22(2,3)4/h7-9,11-12,19-20H,10,13-16H2,1-6H3/t19-,20+/m0/s1 |
| InChIKey | UCNPXZMILWUFPG-VQTJNVASSA-N |
| XLogP | 4.74 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|