C34H59NO6Si2 — CID 134917824
7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-1-[(2S)-2-(phenylmethoxymethyl)piperidin-1-yl]octane-1,2,3-trione (PubChem CID 134917824) has the molecular formula C34H59NO6Si2 and a molecular weight of 634.02 g/mol. Its IUPAC name is 7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-1-[(2S)-2-(phenylmethoxymethyl)piperidin-1-yl]octane-1,2,3-trione.
| Compound Name | 7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-1-[(2S)-2-(phenylmethoxymethyl)piperidin-1-yl]octane-1,2,3-trione |
|---|---|
| PubChem CID | 134917824 |
| Molecular Formula | C34H59NO6Si2 |
| Molecular Weight | 634.02 g/mol |
| Exact Mass | 633.39 |
| IUPAC Name | 7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-1-[(2S)-2-(phenylmethoxymethyl)piperidin-1-yl]octane-1,2,3-trione |
| SMILES | CC(CCC(CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C(=O)C(=O)C(=O)N1CCCC[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C34H59NO6Si2/c1-26(20-21-29(41-43(10,11)34(5,6)7)25-40-42(8,9)33(2,3)4)30(36)31(37)32(38)35-22-16-15-19-28(35)24-39-23-27-17-13-12-14-18-27/h12-14,17-18,26,28-29H,15-16,19-25H2,1-11H3/t26?,28-,29?/m0/s1 |
| InChIKey | UOCOUUYNMCCZAF-STJKXBAKSA-N |
| XLogP | 7.55 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.02 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|