C33H55NO7Si2 — CID 134917530
benzyl (2S)-1-[7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-2,3-dioxooctanoyl]pyrrolidine-2-carboxylate (PubChem CID 134917530) has the molecular formula C33H55NO7Si2 and a molecular weight of 633.98 g/mol. Its IUPAC name is benzyl (2S)-1-[7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-2,3-dioxooctanoyl]pyrrolidine-2-carboxylate.
| Compound Name | benzyl (2S)-1-[7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-2,3-dioxooctanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 134917530 |
| Molecular Formula | C33H55NO7Si2 |
| Molecular Weight | 633.98 g/mol |
| Exact Mass | 633.35 |
| IUPAC Name | benzyl (2S)-1-[7,8-bis[[tert-butyl(dimethyl)silyl]oxy]-4-methyl-2,3-dioxooctanoyl]pyrrolidine-2-carboxylate |
| SMILES | CC(CCC(CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C)C(=O)C(=O)C(=O)N1CCC[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H55NO7Si2/c1-24(19-20-26(41-43(10,11)33(5,6)7)23-40-42(8,9)32(2,3)4)28(35)29(36)30(37)34-21-15-18-27(34)31(38)39-22-25-16-13-12-14-17-25/h12-14,16-17,24,26-27H,15,18-23H2,1-11H3/t24?,26?,27-/m0/s1 |
| InChIKey | FEEWFLMARATJFQ-SDMRFKEVSA-N |
| XLogP | 6.69 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.98 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|