C23H37NO4Si — CID 134941892
1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-[(2R)-2-phenylmethoxypropanoyl]piperidin-2-one (PubChem CID 134941892) has the molecular formula C23H37NO4Si and a molecular weight of 419.64 g/mol. Its IUPAC name is 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-[(2R)-2-phenylmethoxypropanoyl]piperidin-2-one.
| Compound Name | 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-[(2R)-2-phenylmethoxypropanoyl]piperidin-2-one |
|---|---|
| PubChem CID | 134941892 |
| Molecular Formula | C23H37NO4Si |
| Molecular Weight | 419.64 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | 1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-[(2R)-2-phenylmethoxypropanoyl]piperidin-2-one |
| SMILES | C[C@@H](OCc1ccccc1)C(=O)C1CCCN(CCO[Si](C)(C)C(C)(C)C)C1=O |
| InChI | InChI=1S/C23H37NO4Si/c1-18(27-17-19-11-8-7-9-12-19)21(25)20-13-10-14-24(22(20)26)15-16-28-29(5,6)23(2,3)4/h7-9,11-12,18,20H,10,13-17H2,1-6H3/t18-,20?/m1/s1 |
| InChIKey | ISZCNGOYFVDWND-QSVWIEALSA-N |
| XLogP | 4.42 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.64 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|