C26H37NO6Si — CID 15468848
8a-O-benzyl 2-O-methyl (4S,4aS,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-1-oxo-4,4a,5,8-tetrahydro-3H-isoquinoline-2,8a-dicarboxylate (PubChem CID 15468848) has the molecular formula C26H37NO6Si and a molecular weight of 487.67 g/mol. Its IUPAC name is 8a-O-benzyl 2-O-methyl (4S,4aS,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-1-oxo-4,4a,5,8-tetrahydro-3H-isoquinoline-2,8a-dicarboxylate.
| Compound Name | 8a-O-benzyl 2-O-methyl (4S,4aS,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-1-oxo-4,4a,5,8-tetrahydro-3H-isoquinoline-2,8a-dicarboxylate |
|---|---|
| PubChem CID | 15468848 |
| Molecular Formula | C26H37NO6Si |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 8a-O-benzyl 2-O-methyl (4S,4aS,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-6-methyl-1-oxo-4,4a,5,8-tetrahydro-3H-isoquinoline-2,8a-dicarboxylate |
| SMILES | COC(=O)N1C[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]2CC(C)=CC[C@@]2(C(=O)OCc2ccccc2)C1=O |
| InChI | InChI=1S/C26H37NO6Si/c1-18-13-14-26(23(29)32-17-19-11-9-8-10-12-19)20(15-18)21(33-34(6,7)25(2,3)4)16-27(22(26)28)24(30)31-5/h8-13,20-21H,14-17H2,1-7H3/t20-,21-,26+/m1/s1 |
| InChIKey | YEYKECKHRFSTDF-YPCDYVTLSA-N |
| XLogP | 5.07 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|