C24H37NO5Si — CID 54440426
benzyl (4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(1-ethoxycarbonylcyclopropyl)pyrrolidine-1-carboxylate (PubChem CID 54440426) has the molecular formula C24H37NO5Si and a molecular weight of 447.65 g/mol. Its IUPAC name is benzyl (4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(1-ethoxycarbonylcyclopropyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(1-ethoxycarbonylcyclopropyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 54440426 |
| Molecular Formula | C24H37NO5Si |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.24 |
| IUPAC Name | benzyl (4S)-3-[tert-butyl(dimethyl)silyl]oxy-4-(1-ethoxycarbonylcyclopropyl)pyrrolidine-1-carboxylate |
| SMILES | CCOC(=O)C1([C@H]2CN(C(=O)OCc3ccccc3)CC2O[Si](C)(C)C(C)(C)C)CC1 |
| InChI | InChI=1S/C24H37NO5Si/c1-7-28-21(26)24(13-14-24)19-15-25(16-20(19)30-31(5,6)23(2,3)4)22(27)29-17-18-11-9-8-10-12-18/h8-12,19-20H,7,13-17H2,1-6H3/t19-,20?/m0/s1 |
| InChIKey | WNSBCOQIUYNJKY-XJDOXCRVSA-N |
| XLogP | 4.99 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|