C20H31NO4Si — CID 45103067
benzyl (2S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-formyl-3-methylpyrrolidine-1-carboxylate (PubChem CID 45103067) has the molecular formula C20H31NO4Si and a molecular weight of 377.56 g/mol. Its IUPAC name is benzyl (2S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-formyl-3-methylpyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-formyl-3-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 45103067 |
| Molecular Formula | C20H31NO4Si |
| Molecular Weight | 377.56 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | benzyl (2S,3R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-formyl-3-methylpyrrolidine-1-carboxylate |
| SMILES | C[C@H]1[C@@H](O[Si](C)(C)C(C)(C)C)CN(C(=O)OCc2ccccc2)[C@@H]1C=O |
| InChI | InChI=1S/C20H31NO4Si/c1-15-17(13-22)21(12-18(15)25-26(5,6)20(2,3)4)19(23)24-14-16-10-8-7-9-11-16/h7-11,13,15,17-18H,12,14H2,1-6H3/t15-,17-,18+/m1/s1 |
| InChIKey | IFFLHVYYEKQRKL-NXHRZFHOSA-N |
| XLogP | 4.23 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.56 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|