C20H30FNO4Si — CID 91451662
benzyl (3S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(fluoromethyl)-2-oxopyrrolidine-1-carboxylate (PubChem CID 91451662) has the molecular formula C20H30FNO4Si and a molecular weight of 395.55 g/mol. Its IUPAC name is benzyl (3S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(fluoromethyl)-2-oxopyrrolidine-1-carboxylate.
| Compound Name | benzyl (3S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(fluoromethyl)-2-oxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 91451662 |
| Molecular Formula | C20H30FNO4Si |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | benzyl (3S,5S)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-(fluoromethyl)-2-oxopyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@@H]1C[C@H](CF)C(=O)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H30FNO4Si/c1-20(2,3)27(4,5)26-14-17-11-16(12-21)18(23)22(17)19(24)25-13-15-9-7-6-8-10-15/h6-10,16-17H,11-14H2,1-5H3/t16-,17+/m1/s1 |
| InChIKey | BYADOQCJPNKASR-SJORKVTESA-N |
| XLogP | 4.53 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|