C31H45NO5Si — CID 10875214
methyl (E,4S,5S)-5-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-[tert-butyl(dimethyl)silyl]oxy-6-phenylhex-2-enoate (PubChem CID 10875214) has the molecular formula C31H45NO5Si and a molecular weight of 539.79 g/mol. Its IUPAC name is methyl (E,4S,5S)-5-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-[tert-butyl(dimethyl)silyl]oxy-6-phenylhex-2-enoate.
| Compound Name | methyl (E,4S,5S)-5-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-[tert-butyl(dimethyl)silyl]oxy-6-phenylhex-2-enoate |
|---|---|
| PubChem CID | 10875214 |
| Molecular Formula | C31H45NO5Si |
| Molecular Weight | 539.79 g/mol |
| Exact Mass | 539.31 |
| IUPAC Name | methyl (E,4S,5S)-5-[benzyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-4-[tert-butyl(dimethyl)silyl]oxy-6-phenylhex-2-enoate |
| SMILES | COC(=O)/C=C/[C@H](O[Si](C)(C)C(C)(C)C)[C@H](Cc1ccccc1)N(Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C31H45NO5Si/c1-30(2,3)36-29(34)32(23-25-18-14-11-15-19-25)26(22-24-16-12-10-13-17-24)27(20-21-28(33)35-7)37-38(8,9)31(4,5)6/h10-21,26-27H,22-23H2,1-9H3/b21-20+/t26-,27-/m0/s1 |
| InChIKey | PKPDKCGAHIRZMP-JKXJDDOZSA-N |
| XLogP | 7.15 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.79 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|