C26H37NO4Si — CID 139120368
tert-butyl (2S,3S)-3-(tert-butyl-hydroxy-phenylsilyl)oxy-2-phenylpiperidine-1-carboxylate (PubChem CID 139120368) has the molecular formula C26H37NO4Si and a molecular weight of 455.67 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-(tert-butyl-hydroxy-phenylsilyl)oxy-2-phenylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S)-3-(tert-butyl-hydroxy-phenylsilyl)oxy-2-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 139120368 |
| Molecular Formula | C26H37NO4Si |
| Molecular Weight | 455.67 g/mol |
| Exact Mass | 455.25 |
| IUPAC Name | tert-butyl (2S,3S)-3-(tert-butyl-hydroxy-phenylsilyl)oxy-2-phenylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](O[Si@@](O)(c2ccccc2)C(C)(C)C)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C26H37NO4Si/c1-25(2,3)30-24(28)27-19-13-18-22(23(27)20-14-9-7-10-15-20)31-32(29,26(4,5)6)21-16-11-8-12-17-21/h7-12,14-17,22-23,29H,13,18-19H2,1-6H3/t22-,23-,32-/m0/s1 |
| InChIKey | KYODAWFLTWWJPK-HYUGZUBYSA-N |
| XLogP | 5.29 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.67 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|