C16H23NO3 — CID 10901890
tert-butyl (2S,3S)-3-hydroxy-2-phenylpiperidine-1-carboxylate (PubChem CID 10901890) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is tert-butyl (2S,3S)-3-hydroxy-2-phenylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (2S,3S)-3-hydroxy-2-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 10901890 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | tert-butyl (2S,3S)-3-hydroxy-2-phenylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H](O)[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C16H23NO3/c1-16(2,3)20-15(19)17-11-7-10-13(18)14(17)12-8-5-4-6-9-12/h4-6,8-9,13-14,18H,7,10-11H2,1-3H3/t13-,14-/m0/s1 |
| InChIKey | ATJRDIDZQTXJLY-KBPBESRZSA-N |
| XLogP | 3.12 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |