C27H39NO3Si — CID 134884418
ethyl (E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-4-(dibenzylamino)pent-2-enoate (PubChem CID 134884418) has the molecular formula C27H39NO3Si and a molecular weight of 453.70 g/mol. Its IUPAC name is ethyl (E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-4-(dibenzylamino)pent-2-enoate.
| Compound Name | ethyl (E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-4-(dibenzylamino)pent-2-enoate |
|---|---|
| PubChem CID | 134884418 |
| Molecular Formula | C27H39NO3Si |
| Molecular Weight | 453.70 g/mol |
| Exact Mass | 453.27 |
| IUPAC Name | ethyl (E,4R)-5-[tert-butyl(dimethyl)silyl]oxy-4-(dibenzylamino)pent-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CO[Si](C)(C)C(C)(C)C)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C27H39NO3Si/c1-7-30-26(29)19-18-25(22-31-32(5,6)27(2,3)4)28(20-23-14-10-8-11-15-23)21-24-16-12-9-13-17-24/h8-19,25H,7,20-22H2,1-6H3/b19-18+/t25-/m1/s1 |
| InChIKey | ZREOXVYXWBQTMX-GKUCLKHTSA-N |
| XLogP | 6.20 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.70 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|