C18H24N2O2 — CID 11616409
ethyl (E,4S)-4-[benzyl(cyanomethyl)amino]hept-2-enoate (PubChem CID 11616409) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is ethyl (E,4S)-4-[benzyl(cyanomethyl)amino]hept-2-enoate.
| Compound Name | ethyl (E,4S)-4-[benzyl(cyanomethyl)amino]hept-2-enoate |
|---|---|
| PubChem CID | 11616409 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | ethyl (E,4S)-4-[benzyl(cyanomethyl)amino]hept-2-enoate |
| SMILES | CCC[C@@H](/C=C/C(=O)OCC)N(CC#N)Cc1ccccc1 |
| InChI | InChI=1S/C18H24N2O2/c1-3-8-17(11-12-18(21)22-4-2)20(14-13-19)15-16-9-6-5-7-10-16/h5-7,9-12,17H,3-4,8,14-15H2,1-2H3/b12-11+/t17-/m0/s1 |
| InChIKey | ZJWSQNOGUISQQP-FLVLSHQESA-N |
| XLogP | 3.30 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|