C17H22N2O2 — CID 11580090
ethyl (E,4S)-4-[benzyl(cyanomethyl)amino]hex-2-enoate (PubChem CID 11580090) has the molecular formula C17H22N2O2 and a molecular weight of 286.38 g/mol. Its IUPAC name is ethyl (E,4S)-4-[benzyl(cyanomethyl)amino]hex-2-enoate.
| Compound Name | ethyl (E,4S)-4-[benzyl(cyanomethyl)amino]hex-2-enoate |
|---|---|
| PubChem CID | 11580090 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | ethyl (E,4S)-4-[benzyl(cyanomethyl)amino]hex-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](CC)N(CC#N)Cc1ccccc1 |
| InChI | InChI=1S/C17H22N2O2/c1-3-16(10-11-17(20)21-4-2)19(13-12-18)14-15-8-6-5-7-9-15/h5-11,16H,3-4,13-14H2,1-2H3/b11-10+/t16-/m0/s1 |
| InChIKey | LEPUWKHBWYYFPI-OFAQMXQXSA-N |
| XLogP | 2.91 |
| TPSA | 53.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|